C16H13N5O5 — CID 6069703
2-[(2Z)-2-[2-amino-1-[(2-carboxyphenyl)diazenyl]-2-oxoethylidene]hydrazinyl]benzoic acid (PubChem CID 6069703) has the molecular formula C16H13N5O5 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-[(2Z)-2-[2-amino-1-[(2-carboxyphenyl)diazenyl]-2-oxoethylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[(2Z)-2-[2-amino-1-[(2-carboxyphenyl)diazenyl]-2-oxoethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 6069703 |
| Molecular Formula | C16H13N5O5 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2Z)-2-[2-amino-1-[(2-carboxyphenyl)diazenyl]-2-oxoethylidene]hydrazinyl]benzoic acid |
| SMILES | NC(=O)C(=N/Nc1ccccc1C(=O)O)/N=N/c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H13N5O5/c17-13(22)14(20-18-11-7-3-1-5-9(11)15(23)24)21-19-12-8-4-2-6-10(12)16(25)26/h1-8,18H,(H2,17,22)(H,23,24)(H,25,26)/b20-14-,21-19+ |
| InChIKey | OHRQBJCZZMUBPL-ZSTRDAJGSA-N |
| XLogP | 2.08 |
| TPSA | 166.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|