C20H16N4NaO6S — CID 162394261
CID 162394261 (PubChem CID 162394261) has the molecular formula C20H16N4NaO6S and a molecular weight of 463.43 g/mol.
| Compound Name | CID 162394261 |
|---|---|
| PubChem CID | 162394261 |
| Molecular Formula | C20H16N4NaO6S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1/N=N/C(=NNc1cc(S(=O)(=O)O)ccc1O)c1ccccc1.[Na] |
| InChI | InChI=1S/C20H16N4O6S.Na/c25-18-11-10-14(31(28,29)30)12-17(18)22-24-19(13-6-2-1-3-7-13)23-21-16-9-5-4-8-15(16)20(26)27;/h1-12,22,25H,(H,26,27)(H,28,29,30);/b23-21+,24-19?; |
| InChIKey | RYOOQCIEXNTVNH-JKALZEJKSA-N |
| XLogP | 3.51 |
| TPSA | 161.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|