C22H20N4O6S — CID 135984627
2-[[2-[[2-hydroxy-3-(methylamino)-5-sulfophenyl]hydrazinylidene]-2-phenylethylidene]amino]benzoic acid (PubChem CID 135984627) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is 2-[[2-[[2-hydroxy-3-(methylamino)-5-sulfophenyl]hydrazinylidene]-2-phenylethylidene]amino]benzoic acid.
| Compound Name | 2-[[2-[[2-hydroxy-3-(methylamino)-5-sulfophenyl]hydrazinylidene]-2-phenylethylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 135984627 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-[[2-[[2-hydroxy-3-(methylamino)-5-sulfophenyl]hydrazinylidene]-2-phenylethylidene]amino]benzoic acid |
| SMILES | CNc1cc(S(=O)(=O)O)cc(NN=C(/C=N/c2ccccc2C(=O)O)c2ccccc2)c1O |
| InChI | InChI=1S/C22H20N4O6S/c1-23-18-11-15(33(30,31)32)12-19(21(18)27)25-26-20(14-7-3-2-4-8-14)13-24-17-10-6-5-9-16(17)22(28)29/h2-13,23,25,27H,1H3,(H,28,29)(H,30,31,32)/b24-13+,26-20? |
| InChIKey | VFQOAJUFMTUFQD-SZPRGUNASA-N |
| XLogP | 3.60 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|