C20H17N5O9S2 — CID 135430241
2-[[N-(3-amino-2-hydroxy-5-sulfoanilino)-C-phenylcarbonimidoyl]diazenyl]-4-sulfobenzoic acid (PubChem CID 135430241) has the molecular formula C20H17N5O9S2 and a molecular weight of 535.52 g/mol. Its IUPAC name is 2-[[N-(3-amino-2-hydroxy-5-sulfoanilino)-C-phenylcarbonimidoyl]diazenyl]-4-sulfobenzoic acid.
| Compound Name | 2-[[N-(3-amino-2-hydroxy-5-sulfoanilino)-C-phenylcarbonimidoyl]diazenyl]-4-sulfobenzoic acid |
|---|---|
| PubChem CID | 135430241 |
| Molecular Formula | C20H17N5O9S2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 2-[[N-(3-amino-2-hydroxy-5-sulfoanilino)-C-phenylcarbonimidoyl]diazenyl]-4-sulfobenzoic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc(NN=C(/N=N/c2cc(S(=O)(=O)O)ccc2C(=O)O)c2ccccc2)c1O |
| InChI | InChI=1S/C20H17N5O9S2/c21-15-8-13(36(32,33)34)10-17(18(15)26)23-25-19(11-4-2-1-3-5-11)24-22-16-9-12(35(29,30)31)6-7-14(16)20(27)28/h1-10,23,26H,21H2,(H,27,28)(H,29,30,31)(H,32,33,34)/b24-22+,25-19? |
| InChIKey | CRTKZGVOJRYZAX-ATCXFKFGSA-N |
| XLogP | 2.72 |
| TPSA | 241.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|