C34H30ClN9O5S — CID 161082801
3-[[4-chloro-6-(N-ethyl-3-prop-2-enylanilino)-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid (PubChem CID 161082801) has the molecular formula C34H30ClN9O5S and a molecular weight of 712.19 g/mol. Its IUPAC name is 3-[[4-chloro-6-(N-ethyl-3-prop-2-enylanilino)-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-[[4-chloro-6-(N-ethyl-3-prop-2-enylanilino)-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 161082801 |
| Molecular Formula | C34H30ClN9O5S |
| Molecular Weight | 712.19 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 3-[[4-chloro-6-(N-ethyl-3-prop-2-enylanilino)-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid |
| SMILES | C=CCc1cccc(N(CC)c2nc(Cl)nc(Nc3cc(S(=O)(=O)O)cc(NN=C(/N=N/c4ccccc4C=O)c4ccccc4)c3O)n2)c1 |
| InChI | InChI=1S/C34H30ClN9O5S/c1-3-11-22-12-10-16-25(18-22)44(4-2)34-38-32(35)37-33(39-34)36-28-19-26(50(47,48)49)20-29(30(28)46)41-43-31(23-13-6-5-7-14-23)42-40-27-17-9-8-15-24(27)21-45/h3,5-10,12-21,41,46H,1,4,11H2,2H3,(H,47,48,49)(H,36,37,38,39)/b42-40+,43-31? |
| InChIKey | YSDJVNJCONPYEP-CSUIADCTSA-N |
| XLogP | 7.48 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.19 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|