C27H27N9O5S — CID 159162967
3-[[4-(dimethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formyl-5-methylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid (PubChem CID 159162967) has the molecular formula C27H27N9O5S and a molecular weight of 589.64 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formyl-5-methylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-[[4-(dimethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formyl-5-methylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 159162967 |
| Molecular Formula | C27H27N9O5S |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 3-[[4-(dimethylamino)-6-methyl-1,3,5-triazin-2-yl]amino]-5-[2-[[(2-formyl-5-methylphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonic acid |
| SMILES | Cc1ccc(C=O)c(/N=N/C(=NNc2cc(S(=O)(=O)O)cc(Nc3nc(C)nc(N(C)C)n3)c2O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N9O5S/c1-16-10-11-19(15-37)21(12-16)32-34-25(18-8-6-5-7-9-18)35-33-23-14-20(42(39,40)41)13-22(24(23)38)30-26-28-17(2)29-27(31-26)36(3)4/h5-15,33,38H,1-4H3,(H,39,40,41)(H,28,29,30,31)/b34-32+,35-25? |
| InChIKey | PUEGULQHIOPFBT-PNWFRDLNSA-N |
| XLogP | 4.62 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|