C24H21ClN8O3 — CID 136654786
N'-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylperoxyanilino]-N-(2-hydroxyphenyl)iminobenzenecarboximidamide (PubChem CID 136654786) has the molecular formula C24H21ClN8O3 and a molecular weight of 504.94 g/mol. Its IUPAC name is N'-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylperoxyanilino]-N-(2-hydroxyphenyl)iminobenzenecarboximidamide.
| Compound Name | N'-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylperoxyanilino]-N-(2-hydroxyphenyl)iminobenzenecarboximidamide |
|---|---|
| PubChem CID | 136654786 |
| Molecular Formula | C24H21ClN8O3 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N'-[4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylperoxyanilino]-N-(2-hydroxyphenyl)iminobenzenecarboximidamide |
| SMILES | COOc1cc(Nc2nc(C)nc(Cl)n2)ccc1N/N=C(/N=N/c1ccccc1O)c1ccccc1 |
| InChI | InChI=1S/C24H21ClN8O3/c1-15-26-23(25)29-24(27-15)28-17-12-13-19(21(14-17)36-35-2)31-33-22(16-8-4-3-5-9-16)32-30-18-10-6-7-11-20(18)34/h3-14,31,34H,1-2H3,(H,26,27,28,29)/b32-30+,33-22+ |
| InChIKey | KHWLCWIIZBJJLU-OSSGOOQOSA-N |
| XLogP | 5.78 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|