About 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide
4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide (PubChem CID 137331203) has the molecular formula C21H19BrN4O2
and a molecular weight of 439.31 g/mol. Its IUPAC name is 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide |
| PubChem CID | 137331203 |
| Molecular Formula | C21H19BrN4O2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide |
| SMILES | Oc1ccccc1/N=N/C(=N\Nc1ccccc1O)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C21H19BrN4O2/c22-14-13-15-9-11-16(12-10-15)21(25-23-17-5-1-3-7-19(17)27)26-24-18-6-2-4-8-20(18)28/h1-12,23,27-28H,13-14H2/b25-21-,26-24+ |
| InChIKey | PBRDWEONRSMYPX-LXGJOWSGSA-N |
| XLogP | 5.59 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide?
The IUPAC name of 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide (CID 137331203) is 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide.
What is the SMILES notation for 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide?
The canonical SMILES for 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide is Oc1ccccc1/N=N/C(=N\Nc1ccccc1O)c1ccc(CCBr)cc1.
What is the InChIKey of 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide?
The InChIKey is PBRDWEONRSMYPX-LXGJOWSGSA-N. The full InChI is InChI=1S/C21H19BrN4O2/c22-14-13-15-9-11-16(12-10-15)21(25-23-17-5-1-3-7-19(17)27)26-24-18-6-2-4-8-20(18)28/h1-12,23,27-28H,13-14H2/b25-21-,26-24+.
What are the key properties of 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide?
4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide has a molecular weight of 439.31 g/mol, XLogP of 5.59, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethyl)-N'-(2-hydroxyanilino)-N-(2-hydroxyphenyl)iminobenzenecarboximidamide is sourced from PubChem (CID 137331203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).