C32H30Br2S4 — CID 143639420
(Z)-1-[4-(2-bromoethyl)phenyl]-2-phenylethene-1,2-dithiol (PubChem CID 143639420) has the molecular formula C32H30Br2S4 and a molecular weight of 702.67 g/mol. Its IUPAC name is (Z)-1-[4-(2-bromoethyl)phenyl]-2-phenylethene-1,2-dithiol.
| Compound Name | (Z)-1-[4-(2-bromoethyl)phenyl]-2-phenylethene-1,2-dithiol |
|---|---|
| PubChem CID | 143639420 |
| Molecular Formula | C32H30Br2S4 |
| Molecular Weight | 702.67 g/mol |
| Exact Mass | 699.96 |
| IUPAC Name | (Z)-1-[4-(2-bromoethyl)phenyl]-2-phenylethene-1,2-dithiol |
| SMILES | S/C(=C(\S)c1ccc(CCBr)cc1)c1ccccc1.S/C(=C(\S)c1ccc(CCBr)cc1)c1ccccc1 |
| InChI | InChI=1S/2C16H15BrS2/c2*17-11-10-12-6-8-14(9-7-12)16(19)15(18)13-4-2-1-3-5-13/h2*1-9,18-19H,10-11H2/b2*16-15- |
| InChIKey | HEXXYEPCQPAEJW-QZGBSHQZSA-N |
| XLogP | 10.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.67 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|