C21H20N4S2 — CID 68501982
N'-(2-methyl-3-sulfanylanilino)-N-(2-methyl-3-sulfanylphenyl)iminobenzenecarboximidamide (PubChem CID 68501982) has the molecular formula C21H20N4S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N'-(2-methyl-3-sulfanylanilino)-N-(2-methyl-3-sulfanylphenyl)iminobenzenecarboximidamide.
| Compound Name | N'-(2-methyl-3-sulfanylanilino)-N-(2-methyl-3-sulfanylphenyl)iminobenzenecarboximidamide |
|---|---|
| PubChem CID | 68501982 |
| Molecular Formula | C21H20N4S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N'-(2-methyl-3-sulfanylanilino)-N-(2-methyl-3-sulfanylphenyl)iminobenzenecarboximidamide |
| SMILES | Cc1c(S)cccc1/N=N/C(=NNc1cccc(S)c1C)c1ccccc1 |
| InChI | InChI=1S/C21H20N4S2/c1-14-17(10-6-12-19(14)26)22-24-21(16-8-4-3-5-9-16)25-23-18-11-7-13-20(27)15(18)2/h3-13,22,26-27H,1-2H3/b24-21?,25-23+ |
| InChIKey | ZOCXFCZSDQSTMW-FCTDIGPBSA-N |
| XLogP | 6.44 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|