C19H15N6O3- — CID 135554596
4-[2-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)diazenyl]-phenylmethylidene]hydrazinyl]benzoate (PubChem CID 135554596) has the molecular formula C19H15N6O3- and a molecular weight of 375.37 g/mol. Its IUPAC name is 4-[2-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)diazenyl]-phenylmethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[2-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)diazenyl]-phenylmethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135554596 |
| Molecular Formula | C19H15N6O3- |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 4-[2-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)diazenyl]-phenylmethylidene]hydrazinyl]benzoate |
| SMILES | Cc1cc(=O)[nH]c(/N=N/C(=NNc2ccc(C(=O)[O-])cc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N6O3/c1-12-11-16(26)21-19(20-12)25-24-17(13-5-3-2-4-6-13)23-22-15-9-7-14(8-10-15)18(27)28/h2-11,22H,1H3,(H,27,28)(H,20,21,26)/p-1/b23-17?,25-24+ |
| InChIKey | LBIKTJWFJJVLLM-ZUWJXVMFSA-M |
| XLogP | 2.00 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|