About N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide
N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide (PubChem CID 136904746) has the molecular formula C20H13N9O6
and a molecular weight of 475.38 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide.
Molecular Properties
| Compound Name | N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide |
| PubChem CID | 136904746 |
| Molecular Formula | C20H13N9O6 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NN=C(/N=N/c2nc3ccccc3[nH]2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13N9O6/c30-27(31)13-10-16(28(32)33)18(17(11-13)29(34)35)23-24-19(12-6-2-1-3-7-12)25-26-20-21-14-8-4-5-9-15(14)22-20/h1-11,23H,(H,21,22)/b24-19?,26-25+ |
| InChIKey | SFPYUIUQBFFNRB-DBQCWECDSA-N |
| XLogP | 4.85 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide?
The IUPAC name of N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide (CID 136904746) is N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide.
What is the SMILES notation for N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide?
The canonical SMILES for N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide is O=[N+]([O-])c1cc([N+](=O)[O-])c(NN=C(/N=N/c2nc3ccccc3[nH]2)c2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide?
The InChIKey is SFPYUIUQBFFNRB-DBQCWECDSA-N. The full InChI is InChI=1S/C20H13N9O6/c30-27(31)13-10-16(28(32)33)18(17(11-13)29(34)35)23-24-19(12-6-2-1-3-7-12)25-26-20-21-14-8-4-5-9-15(14)22-20/h1-11,23H,(H,21,22)/b24-19?,26-25+.
What are the key properties of N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide?
N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide has a molecular weight of 475.38 g/mol, XLogP of 4.85, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-benzimidazol-2-ylimino)-N'-(2,4,6-trinitroanilino)benzenecarboximidamide is sourced from PubChem (CID 136904746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).