C16H15ClN4O5 — CID 102397007
(4E)-4-[(2-chloro-4,6-dinitrophenyl)hydrazinylidene]-4-phenylbutan-2-ol (PubChem CID 102397007) has the molecular formula C16H15ClN4O5 and a molecular weight of 378.77 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-4,6-dinitrophenyl)hydrazinylidene]-4-phenylbutan-2-ol.
| Compound Name | (4E)-4-[(2-chloro-4,6-dinitrophenyl)hydrazinylidene]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 102397007 |
| Molecular Formula | C16H15ClN4O5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (4E)-4-[(2-chloro-4,6-dinitrophenyl)hydrazinylidene]-4-phenylbutan-2-ol |
| SMILES | CC(O)C/C(=N\Nc1c(Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H15ClN4O5/c1-10(22)7-14(11-5-3-2-4-6-11)18-19-16-13(17)8-12(20(23)24)9-15(16)21(25)26/h2-6,8-10,19,22H,7H2,1H3/b18-14+ |
| InChIKey | QUYBRTBWUJLEAV-NBVRZTHBSA-N |
| XLogP | 3.74 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|