C14H9BrN5O3- — CID 7460190
2-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-6-bromo-4-nitrophenolate (PubChem CID 7460190) has the molecular formula C14H9BrN5O3- and a molecular weight of 375.16 g/mol. Its IUPAC name is 2-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-6-bromo-4-nitrophenolate.
| Compound Name | 2-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-6-bromo-4-nitrophenolate |
|---|---|
| PubChem CID | 7460190 |
| Molecular Formula | C14H9BrN5O3- |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-6-bromo-4-nitrophenolate |
| SMILES | O=[N+]([O-])c1cc(Br)c([O-])c(/C=N\Nc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C14H10BrN5O3/c15-10-6-9(20(22)23)5-8(13(10)21)7-16-19-14-17-11-3-1-2-4-12(11)18-14/h1-7,21H,(H2,17,18,19)/p-1/b16-7- |
| InChIKey | NCCGWVHFZIHLGW-APSNUPSMSA-M |
| XLogP | 2.75 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|