C20H17CuN5O9S2 — CID 135705167
2-[(2Z)-2-[[(2E)-2-(5-amino-6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-phenylmethylidene]hydrazinyl]-4-sulfobenzoic acid;copper (PubChem CID 135705167) has the molecular formula C20H17CuN5O9S2 and a molecular weight of 599.06 g/mol. Its IUPAC name is 2-[(2Z)-2-[[(2E)-2-(5-amino-6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-phenylmethylidene]hydrazinyl]-4-sulfobenzoic acid;copper.
| Compound Name | 2-[(2Z)-2-[[(2E)-2-(5-amino-6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-phenylmethylidene]hydrazinyl]-4-sulfobenzoic acid;copper |
|---|---|
| PubChem CID | 135705167 |
| Molecular Formula | C20H17CuN5O9S2 |
| Molecular Weight | 599.06 g/mol |
| Exact Mass | 597.98 |
| IUPAC Name | 2-[(2Z)-2-[[(2E)-2-(5-amino-6-oxo-3-sulfocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-phenylmethylidene]hydrazinyl]-4-sulfobenzoic acid;copper |
| SMILES | NC1=CC(S(=O)(=O)O)=C/C(=N\N/C(=N\Nc2cc(S(=O)(=O)O)ccc2C(=O)O)c2ccccc2)C1=O.[Cu] |
| InChI | InChI=1S/C20H17N5O9S2.Cu/c21-15-8-13(36(32,33)34)10-17(18(15)26)23-25-19(11-4-2-1-3-5-11)24-22-16-9-12(35(29,30)31)6-7-14(16)20(27)28;/h1-10,22H,21H2,(H,24,25)(H,27,28)(H,29,30,31)(H,32,33,34);/b23-17+; |
| InChIKey | VNSCGVOKTAXMCV-YFZNFVDXSA-N |
| XLogP | 0.55 |
| TPSA | 237.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.06 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|