C29H24N8O12S3 — CID 10952812
2-[[4-amino-6-[[(7E)-8-oxo-6-sulfo-7-[(6-sulfo-2,3-dihydro-1H-inden-5-yl)hydrazinylidene]naphthalen-1-yl]amino]-1,3,5-triazin-2-yl]amino]-4-sulfobenzoic acid (PubChem CID 10952812) has the molecular formula C29H24N8O12S3 and a molecular weight of 772.76 g/mol. Its IUPAC name is 2-[[4-amino-6-[[(7E)-8-oxo-6-sulfo-7-[(6-sulfo-2,3-dihydro-1H-inden-5-yl)hydrazinylidene]naphthalen-1-yl]amino]-1,3,5-triazin-2-yl]amino]-4-sulfobenzoic acid.
| Compound Name | 2-[[4-amino-6-[[(7E)-8-oxo-6-sulfo-7-[(6-sulfo-2,3-dihydro-1H-inden-5-yl)hydrazinylidene]naphthalen-1-yl]amino]-1,3,5-triazin-2-yl]amino]-4-sulfobenzoic acid |
|---|---|
| PubChem CID | 10952812 |
| Molecular Formula | C29H24N8O12S3 |
| Molecular Weight | 772.76 g/mol |
| Exact Mass | 772.07 |
| IUPAC Name | 2-[[4-amino-6-[[(7E)-8-oxo-6-sulfo-7-[(6-sulfo-2,3-dihydro-1H-inden-5-yl)hydrazinylidene]naphthalen-1-yl]amino]-1,3,5-triazin-2-yl]amino]-4-sulfobenzoic acid |
| SMILES | Nc1nc(Nc2cc(S(=O)(=O)O)ccc2C(=O)O)nc(Nc2cccc3c2C(=O)/C(=N\Nc2cc4c(cc2S(=O)(=O)O)CCC4)C(S(=O)(=O)O)=C3)n1 |
| InChI | InChI=1S/C29H24N8O12S3/c30-27-33-28(35-29(34-27)32-19-12-16(50(41,42)43)7-8-17(19)26(39)40)31-18-6-2-5-15-11-22(52(47,48)49)24(25(38)23(15)18)37-36-20-9-13-3-1-4-14(13)10-21(20)51(44,45)46/h2,5-12,36H,1,3-4H2,(H,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)(H4,30,31,32,33,34,35)/b37-24- |
| InChIKey | RQXDWACFOQEVMU-PNEAAFPUSA-N |
| XLogP | 2.51 |
| TPSA | 330.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|