C27H19N7O9S — CID 158894990
2-[[4-[[7-[(2-carboxyphenyl)hydrazinylidene]-8-oxo-3-sulfonaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 158894990) has the molecular formula C27H19N7O9S and a molecular weight of 617.56 g/mol. Its IUPAC name is 2-[[4-[[7-[(2-carboxyphenyl)hydrazinylidene]-8-oxo-3-sulfonaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 2-[[4-[[7-[(2-carboxyphenyl)hydrazinylidene]-8-oxo-3-sulfonaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 158894990 |
| Molecular Formula | C27H19N7O9S |
| Molecular Weight | 617.56 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 2-[[4-[[7-[(2-carboxyphenyl)hydrazinylidene]-8-oxo-3-sulfonaphthalen-1-yl]amino]-6-hydroxy-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN=C1C=Cc2cc(S(=O)(=O)O)cc(Nc3nc(O)nc(Nc4ccccc4C(=O)O)n3)c2C1=O |
| InChI | InChI=1S/C27H19N7O9S/c35-22-19(34-33-18-8-4-2-6-16(18)24(38)39)10-9-13-11-14(44(41,42)43)12-20(21(13)22)29-26-30-25(31-27(40)32-26)28-17-7-3-1-5-15(17)23(36)37/h1-12,33H,(H,36,37)(H,38,39)(H,41,42,43)(H3,28,29,30,31,32,40) |
| InChIKey | AVVMDZFJLOERPQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 253.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|