C30H27N7O13S3 — CID 89346808
2-[[4-[3-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]anilino]-6-[methyl(2-sulfoethyl)amino]-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 89346808) has the molecular formula C30H27N7O13S3 and a molecular weight of 789.78 g/mol. Its IUPAC name is 2-[[4-[3-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]anilino]-6-[methyl(2-sulfoethyl)amino]-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 2-[[4-[3-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]anilino]-6-[methyl(2-sulfoethyl)amino]-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 89346808 |
| Molecular Formula | C30H27N7O13S3 |
| Molecular Weight | 789.78 g/mol |
| Exact Mass | 789.08 |
| IUPAC Name | 2-[[4-[3-[(8-hydroxy-3,6-disulfonaphthalen-1-yl)carbamoyl]anilino]-6-[methyl(2-sulfoethyl)amino]-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CN(CCS(=O)(=O)O)c1nc(Nc2cccc(C(=O)Nc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(O)c34)c2)nc(Nc2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C30H27N7O13S3/c1-37(9-10-51(42,43)44)30-35-28(34-29(36-30)33-22-8-3-2-7-21(22)27(40)41)31-18-6-4-5-16(11-18)26(39)32-23-14-19(52(45,46)47)12-17-13-20(53(48,49)50)15-24(38)25(17)23/h2-8,11-15,38H,9-10H2,1H3,(H,32,39)(H,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)(H2,31,33,34,35,36) |
| InChIKey | KPYDKUZICRDJAR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 315.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|