C30H22ClN7O7S2 — CID 122425185
(6Z)-4-[[4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]-5-oxo-6-[(5-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2-sulfonic acid (PubChem CID 122425185) has the molecular formula C30H22ClN7O7S2 and a molecular weight of 692.14 g/mol. Its IUPAC name is (6Z)-4-[[4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]-5-oxo-6-[(5-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2-sulfonic acid.
| Compound Name | (6Z)-4-[[4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]-5-oxo-6-[(5-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 122425185 |
| Molecular Formula | C30H22ClN7O7S2 |
| Molecular Weight | 692.14 g/mol |
| Exact Mass | 691.07 |
| IUPAC Name | (6Z)-4-[[4-chloro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]-5-oxo-6-[(5-sulfonaphthalen-2-yl)hydrazinylidene]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(Nc3cc(S(=O)(=O)O)cc4c3C(=O)/C(=N\Nc3ccc5c(S(=O)(=O)O)cccc5c3)C=C4)n2)cc1 |
| InChI | InChI=1S/C30H22ClN7O7S2/c1-16-5-8-19(9-6-16)32-29-34-28(31)35-30(36-29)33-24-15-21(46(40,41)42)14-18-7-12-23(27(39)26(18)24)38-37-20-10-11-22-17(13-20)3-2-4-25(22)47(43,44)45/h2-15,37H,1H3,(H,40,41,42)(H,43,44,45)(H2,32,33,34,35,36)/b38-23- |
| InChIKey | MWCKCDUHXYHCFX-LRIZEKIPSA-N |
| XLogP | 5.64 |
| TPSA | 212.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.14 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|