C21H19CuN4O9S2 — CID 159638679
[[[[2-carboxy-4-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]-phenylmethylidene]amino]-(2-hydroxy-3-methyl-5-sulfophenyl)azanide;copper(1+) (PubChem CID 159638679) has the molecular formula C21H19CuN4O9S2 and a molecular weight of 599.08 g/mol. Its IUPAC name is [[[[2-carboxy-4-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]-phenylmethylidene]amino]-(2-hydroxy-3-methyl-5-sulfophenyl)azanide;copper(1+).
| Compound Name | [[[[2-carboxy-4-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]-phenylmethylidene]amino]-(2-hydroxy-3-methyl-5-sulfophenyl)azanide;copper(1+) |
|---|---|
| PubChem CID | 159638679 |
| Molecular Formula | C21H19CuN4O9S2 |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | [[[[2-carboxy-4-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]-phenylmethylidene]amino]-(2-hydroxy-3-methyl-5-sulfophenyl)azanide;copper(1+) |
| SMILES | Cc1cc(S(=O)(=O)O)cc([N-]N=C(/N=N/c2ccc(S(O)(O)O)cc2C(=O)O)c2ccccc2)c1O.[Cu+] |
| InChI | InChI=1S/C21H20N4O9S2.Cu/c1-12-9-15(36(32,33)34)11-18(19(12)26)23-25-20(13-5-3-2-4-6-13)24-22-17-8-7-14(35(29,30)31)10-16(17)21(27)28;/h2-11H,1H3,(H7,22,23,24,25,26,27,28,29,30,31,32,33,34);/q;+1/p-1 |
| InChIKey | BGFKFJRXQLREGF-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 223.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|