About 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid (PubChem CID 125454343) has the molecular formula C9H11NO3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid |
| PubChem CID | 125454343 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid |
| SMILES | CS(C)(=O)=Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H11NO3S/c1-14(2,13)10-8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChIKey | RLVZRQZUAYCBKF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid?
The IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid (CID 125454343) is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid.
What is the SMILES notation for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid?
The canonical SMILES for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid is CS(C)(=O)=Nc1ccccc1C(=O)O.
What is the InChIKey of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid?
The InChIKey is RLVZRQZUAYCBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c1-14(2,13)10-8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12).
What are the key properties of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid?
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid has a molecular weight of 213.26 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzoic acid is sourced from PubChem (CID 125454343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).