About 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride (PubChem CID 165459973) has the molecular formula C8H10FNO3S2
and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride |
| PubChem CID | 165459973 |
| Molecular Formula | C8H10FNO3S2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride |
| SMILES | CS(C)(=O)=Nc1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C8H10FNO3S2/c1-14(2,11)10-7-5-3-4-6-8(7)15(9,12)13/h3-6H,1-2H3 |
| InChIKey | RWQFWXVQJFFYJV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride?
The IUPAC name of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride (CID 165459973) is 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride?
The canonical SMILES for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride is CS(C)(=O)=Nc1ccccc1S(=O)(=O)F.
What is the InChIKey of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride?
The InChIKey is RWQFWXVQJFFYJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO3S2/c1-14(2,11)10-7-5-3-4-6-8(7)15(9,12)13/h3-6H,1-2H3.
What are the key properties of 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride?
2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride has a molecular weight of 251.30 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[dimethyl(oxo)-λ6-sulfanylidene]amino]benzenesulfonyl fluoride is sourced from PubChem (CID 165459973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).