C8H9Cl2NOS — CID 125454990
(2,5-dichlorophenyl)imino-dimethyl-oxo-λ6-sulfane (PubChem CID 125454990) has the molecular formula C8H9Cl2NOS and a molecular weight of 238.14 g/mol. Its IUPAC name is (2,5-dichlorophenyl)imino-dimethyl-oxo-λ6-sulfane.
| Compound Name | (2,5-dichlorophenyl)imino-dimethyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 125454990 |
| Molecular Formula | C8H9Cl2NOS |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | (2,5-dichlorophenyl)imino-dimethyl-oxo-λ6-sulfane |
| SMILES | CS(C)(=O)=Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H9Cl2NOS/c1-13(2,12)11-8-5-6(9)3-4-7(8)10/h3-5H,1-2H3 |
| InChIKey | WXGHKEBKVVJISK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |