C10H10Cl2N2 — CID 152790361
4-(2,5-dichlorophenyl)iminobut-2-en-2-amine (PubChem CID 152790361) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)iminobut-2-en-2-amine.
| Compound Name | 4-(2,5-dichlorophenyl)iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 152790361 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 4-(2,5-dichlorophenyl)iminobut-2-en-2-amine |
| SMILES | CC(N)=C/C=N/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H10Cl2N2/c1-7(13)4-5-14-10-6-8(11)2-3-9(10)12/h2-6H,13H2,1H3/b7-4?,14-5+ |
| InChIKey | SFZQCKOZXCLZHY-FISATLKLSA-N |
| XLogP | 3.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|