C11H17N3O3 — CID 60697740
N,N-diethyl-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide (PubChem CID 60697740) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N,N-diethyl-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60697740 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N,N-diethyl-2-(3-methyl-2,6-dioxopyrimidin-1-yl)acetamide |
| SMILES | CCN(CC)C(=O)Cn1c(=O)ccn(C)c1=O |
| InChI | InChI=1S/C11H17N3O3/c1-4-13(5-2)10(16)8-14-9(15)6-7-12(3)11(14)17/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | SFUUKYLHOSJYPW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |