C10H17N3O2S — CID 60705490
1,3-dimethyl-6-[(2-methylsulfanylethylamino)methyl]pyrimidine-2,4-dione (PubChem CID 60705490) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1,3-dimethyl-6-[(2-methylsulfanylethylamino)methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[(2-methylsulfanylethylamino)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60705490 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1,3-dimethyl-6-[(2-methylsulfanylethylamino)methyl]pyrimidine-2,4-dione |
| SMILES | CSCCNCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C10H17N3O2S/c1-12-8(7-11-4-5-16-3)6-9(14)13(2)10(12)15/h6,11H,4-5,7H2,1-3H3 |
| InChIKey | QCPFWWNCJIOOCE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|