C9H15N3O3 — CID 60705846
6-[(ethoxyamino)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 60705846) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 6-[(ethoxyamino)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[(ethoxyamino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60705846 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 6-[(ethoxyamino)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCONCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C9H15N3O3/c1-4-15-10-6-7-5-8(13)12(3)9(14)11(7)2/h5,10H,4,6H2,1-3H3 |
| InChIKey | KKGCAJHFWLAHST-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|