C11H7F5N2S — CID 60706687
2,3,4,5,6-pentafluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline (PubChem CID 60706687) has the molecular formula C11H7F5N2S and a molecular weight of 294.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 60706687 |
| Molecular Formula | C11H7F5N2S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline |
| SMILES | Cc1csc(CNc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C11H7F5N2S/c1-4-3-19-5(18-4)2-17-11-9(15)7(13)6(12)8(14)10(11)16/h3,17H,2H2,1H3 |
| InChIKey | YZUZIPQWIVRNCA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|