C13H16ClN3O2 — CID 60707021
2-chloro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-carboxamide (PubChem CID 60707021) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60707021 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-chloro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pyridine-4-carboxamide |
| SMILES | CN(CC(=O)N1CCCC1)C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-16(9-12(18)17-6-2-3-7-17)13(19)10-4-5-15-11(14)8-10/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | SIKPSOFDRFWJTC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|