C12H15Cl2NO4S — CID 60715347
methyl 4-[(3,4-dichlorophenyl)sulfonyl-methylamino]butanoate (PubChem CID 60715347) has the molecular formula C12H15Cl2NO4S and a molecular weight of 340.23 g/mol. Its IUPAC name is methyl 4-[(3,4-dichlorophenyl)sulfonyl-methylamino]butanoate.
| Compound Name | methyl 4-[(3,4-dichlorophenyl)sulfonyl-methylamino]butanoate |
|---|---|
| PubChem CID | 60715347 |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | methyl 4-[(3,4-dichlorophenyl)sulfonyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO4S/c1-15(7-3-4-12(16)19-2)20(17,18)9-5-6-10(13)11(14)8-9/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | IJAOCEDQLHZVSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |