C12H22N2O2 — CID 607158
2,6-bis(aminomethyl)adamantane-2,6-diol (PubChem CID 607158) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,6-bis(aminomethyl)adamantane-2,6-diol.
| Compound Name | 2,6-bis(aminomethyl)adamantane-2,6-diol |
|---|---|
| PubChem CID | 607158 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2,6-bis(aminomethyl)adamantane-2,6-diol |
| SMILES | NCC1(O)C2CC3CC1CC(C2)C3(O)CN |
| InChI | InChI=1S/C12H22N2O2/c13-5-11(15)7-1-8-3-10(11)4-9(2-7)12(8,16)6-14/h7-10,15-16H,1-6,13-14H2 |
| InChIKey | DQLQEJJXGWHRBY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |