C13H17Cl2N3O2 — CID 60718086
3,6-dichloro-N-[2-(diethylamino)-2-oxoethyl]-N-methylpyridine-2-carboxamide (PubChem CID 60718086) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-(diethylamino)-2-oxoethyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[2-(diethylamino)-2-oxoethyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 60718086 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3,6-dichloro-N-[2-(diethylamino)-2-oxoethyl]-N-methylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-4-18(5-2)11(19)8-17(3)13(20)12-9(14)6-7-10(15)16-12/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | BOMJMHASBLMISC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|