C14H20Cl2N2O — CID 60748160
3,6-dichloro-N,N-bis(2-methylpropyl)pyridine-2-carboxamide (PubChem CID 60748160) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 3,6-dichloro-N,N-bis(2-methylpropyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N,N-bis(2-methylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60748160 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3,6-dichloro-N,N-bis(2-methylpropyl)pyridine-2-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-9(2)7-18(8-10(3)4)14(19)13-11(15)5-6-12(16)17-13/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | JJRXJUJNMCSYNM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|