About N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide
N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60724800) has the molecular formula C11H14N2O3S3
and a molecular weight of 318.45 g/mol. Its IUPAC name is N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60724800 |
| Molecular Formula | C11H14N2O3S3 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)N(C)C(C)c1cccs1 |
| InChI | InChI=1S/C11H14N2O3S3/c1-7-10(18-11(14)12-7)19(15,16)13(3)8(2)9-5-4-6-17-9/h4-6,8H,1-3H3,(H,12,14) |
| InChIKey | YZEMJJJMUHOUQA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide (CID 60724800) is N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)N(C)C(C)c1cccs1.
What is the InChIKey of N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is YZEMJJJMUHOUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S3/c1-7-10(18-11(14)12-7)19(15,16)13(3)8(2)9-5-4-6-17-9/h4-6,8H,1-3H3,(H,12,14).
What are the key properties of N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide?
N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 318.45 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-2-oxo-N-(1-thiophen-2-ylethyl)-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60724800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).