C10H6ClF2N3O — CID 60726327
4-chloro-6-(3,4-difluorophenoxy)pyrimidin-5-amine (PubChem CID 60726327) has the molecular formula C10H6ClF2N3O and a molecular weight of 257.63 g/mol. Its IUPAC name is 4-chloro-6-(3,4-difluorophenoxy)pyrimidin-5-amine.
| Compound Name | 4-chloro-6-(3,4-difluorophenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 60726327 |
| Molecular Formula | C10H6ClF2N3O |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 4-chloro-6-(3,4-difluorophenoxy)pyrimidin-5-amine |
| SMILES | Nc1c(Cl)ncnc1Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H6ClF2N3O/c11-9-8(14)10(16-4-15-9)17-5-1-2-6(12)7(13)3-5/h1-4H,14H2 |
| InChIKey | REWAVIFRJDQUPR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |