C11H9ClFN3O2 — CID 82717490
6-(4-chloro-3-fluorophenoxy)-5-methoxypyrimidin-4-amine (PubChem CID 82717490) has the molecular formula C11H9ClFN3O2 and a molecular weight of 269.66 g/mol. Its IUPAC name is 6-(4-chloro-3-fluorophenoxy)-5-methoxypyrimidin-4-amine.
| Compound Name | 6-(4-chloro-3-fluorophenoxy)-5-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 82717490 |
| Molecular Formula | C11H9ClFN3O2 |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 6-(4-chloro-3-fluorophenoxy)-5-methoxypyrimidin-4-amine |
| SMILES | COc1c(N)ncnc1Oc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H9ClFN3O2/c1-17-9-10(14)15-5-16-11(9)18-6-2-3-7(12)8(13)4-6/h2-5H,1H3,(H2,14,15,16) |
| InChIKey | VVQHBNDJCYIEEY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |