C14H26F3NO3 — CID 60729530
1-(2-methylcyclohexyl)oxy-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol (PubChem CID 60729530) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)oxy-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol.
| Compound Name | 1-(2-methylcyclohexyl)oxy-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 60729530 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-(2-methylcyclohexyl)oxy-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol |
| SMILES | CC1CCCCC1OCC(O)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C14H26F3NO3/c1-11-4-2-3-5-13(11)21-9-12(19)8-18-6-7-20-10-14(15,16)17/h11-13,18-19H,2-10H2,1H3 |
| InChIKey | FVXMDQVHDNLWRA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|