C17H26N2OS — CID 60729630
1-(2,6-diethylphenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea (PubChem CID 60729630) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 60729630 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NCCC1CCCO1 |
| InChI | InChI=1S/C17H26N2OS/c1-3-13-7-5-8-14(4-2)16(13)19-17(21)18-11-10-15-9-6-12-20-15/h5,7-8,15H,3-4,6,9-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | ZGQAFWZTBQUYHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|