C13H16Cl2N2OS — CID 60729222
1-(3,4-dichlorophenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea (PubChem CID 60729222) has the molecular formula C13H16Cl2N2OS and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 60729222 |
| Molecular Formula | C13H16Cl2N2OS |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(oxolan-2-yl)ethyl]thiourea |
| SMILES | S=C(NCCC1CCCO1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2OS/c14-11-4-3-9(8-12(11)15)17-13(19)16-6-5-10-2-1-7-18-10/h3-4,8,10H,1-2,5-7H2,(H2,16,17,19) |
| InChIKey | LSSPNAFOZIASIC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|