C12H11F2N3O2 — CID 60736173
3-(difluoromethoxy)-N-(1H-pyrazol-4-ylmethyl)benzamide (PubChem CID 60736173) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(1H-pyrazol-4-ylmethyl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N-(1H-pyrazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60736173 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-(difluoromethoxy)-N-(1H-pyrazol-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1cn[nH]c1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H11F2N3O2/c13-12(14)19-10-3-1-2-9(4-10)11(18)15-5-8-6-16-17-7-8/h1-4,6-7,12H,5H2,(H,15,18)(H,16,17) |
| InChIKey | HRMLTCSGOSAUDG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |