C18H17NO6 — CID 607599
diethyl 2-[[(3,4-dioxonaphthalen-1-yl)amino]methylidene]propanedioate (PubChem CID 607599) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is diethyl 2-[[(3,4-dioxonaphthalen-1-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3,4-dioxonaphthalen-1-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 607599 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | diethyl 2-[[(3,4-dioxonaphthalen-1-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNC1=CC(=O)C(=O)c2ccccc21)C(=O)OCC |
| InChI | InChI=1S/C18H17NO6/c1-3-24-17(22)13(18(23)25-4-2)10-19-14-9-15(20)16(21)12-8-6-5-7-11(12)14/h5-10,19H,3-4H2,1-2H3 |
| InChIKey | ZFMFRELJSJGJCQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|