C15H13NO4 — CID 15186677
ethyl (E)-3-[(1,4-dioxonaphthalen-2-yl)amino]prop-2-enoate (PubChem CID 15186677) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is ethyl (E)-3-[(1,4-dioxonaphthalen-2-yl)amino]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1,4-dioxonaphthalen-2-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 15186677 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | ethyl (E)-3-[(1,4-dioxonaphthalen-2-yl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/NC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H13NO4/c1-2-20-14(18)7-8-16-12-9-13(17)10-5-3-4-6-11(10)15(12)19/h3-9,16H,2H2,1H3/b8-7+ |
| InChIKey | GLRQRAUALLCADM-BQYQJAHWSA-N |
| XLogP | 1.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|