C14H25N3 — CID 60762679
2-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]cyclohexan-1-amine (PubChem CID 60762679) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]cyclohexan-1-amine.
| Compound Name | 2-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 60762679 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]cyclohexan-1-amine |
| SMILES | Cc1[nH]ncc1CCCNC1CCCCC1C |
| InChI | InChI=1S/C14H25N3/c1-11-6-3-4-8-14(11)15-9-5-7-13-10-16-17-12(13)2/h10-11,14-15H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | XURMGBOZHLVLOI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|