C13H18ClN3O3 — CID 60776063
4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)pyridine-2-carboxamide (PubChem CID 60776063) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60776063 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)pyridine-2-carboxamide |
| SMILES | COCCN(CC(=O)N(C)C)C(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-16(2)12(18)9-17(6-7-20-3)13(19)11-8-10(14)4-5-15-11/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | TYVIYNIHNJBHPA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |