C13H23N3O4 — CID 60778061
methyl 3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]propanoate (PubChem CID 60778061) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 60778061 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)C1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H23N3O4/c1-15(2)13(19)16-8-5-10(6-9-16)12(18)14-7-4-11(17)20-3/h10H,4-9H2,1-3H3,(H,14,18) |
| InChIKey | PHBPHRCCMWJIMA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |