C12H19N5O3S — CID 60779473
methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]-propan-2-ylamino]acetate (PubChem CID 60779473) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 60779473 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(=O)CSc1nnnn1C1CC1)C(C)C |
| InChI | InChI=1S/C12H19N5O3S/c1-8(2)16(6-11(19)20-3)10(18)7-21-12-13-14-15-17(12)9-4-5-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZXFJCNCCFVTUMY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |