C15H16BrN3OS — CID 60779524
3-bromo-N-(1-pyridin-2-ylpiperidin-4-yl)thiophene-2-carboxamide (PubChem CID 60779524) has the molecular formula C15H16BrN3OS and a molecular weight of 366.28 g/mol. Its IUPAC name is 3-bromo-N-(1-pyridin-2-ylpiperidin-4-yl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(1-pyridin-2-ylpiperidin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60779524 |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-bromo-N-(1-pyridin-2-ylpiperidin-4-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccccn2)CC1)c1sccc1Br |
| InChI | InChI=1S/C15H16BrN3OS/c16-12-6-10-21-14(12)15(20)18-11-4-8-19(9-5-11)13-3-1-2-7-17-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,18,20) |
| InChIKey | XLPSXHDCGNANBD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |