C13H15Br2N3 — CID 60781763
N-[1-(2,4-dibromophenyl)ethyl]-1-ethylpyrazol-4-amine (PubChem CID 60781763) has the molecular formula C13H15Br2N3 and a molecular weight of 373.09 g/mol. Its IUPAC name is N-[1-(2,4-dibromophenyl)ethyl]-1-ethylpyrazol-4-amine.
| Compound Name | N-[1-(2,4-dibromophenyl)ethyl]-1-ethylpyrazol-4-amine |
|---|---|
| PubChem CID | 60781763 |
| Molecular Formula | C13H15Br2N3 |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | N-[1-(2,4-dibromophenyl)ethyl]-1-ethylpyrazol-4-amine |
| SMILES | CCn1cc(NC(C)c2ccc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C13H15Br2N3/c1-3-18-8-11(7-16-18)17-9(2)12-5-4-10(14)6-13(12)15/h4-9,17H,3H2,1-2H3 |
| InChIKey | HPCFSHAYIFGINY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |