C17H16Br2N2 — CID 60781809
4-[1-[1-(2,4-dibromophenyl)ethylamino]ethyl]benzonitrile (PubChem CID 60781809) has the molecular formula C17H16Br2N2 and a molecular weight of 408.14 g/mol. Its IUPAC name is 4-[1-[1-(2,4-dibromophenyl)ethylamino]ethyl]benzonitrile.
| Compound Name | 4-[1-[1-(2,4-dibromophenyl)ethylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 60781809 |
| Molecular Formula | C17H16Br2N2 |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 4-[1-[1-(2,4-dibromophenyl)ethylamino]ethyl]benzonitrile |
| SMILES | CC(NC(C)c1ccc(Br)cc1Br)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16Br2N2/c1-11(14-5-3-13(10-20)4-6-14)21-12(2)16-8-7-15(18)9-17(16)19/h3-9,11-12,21H,1-2H3 |
| InChIKey | BGWZRHDWIDBMJT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |