C16H16Br2N2O — CID 60781874
3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzamide (PubChem CID 60781874) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzamide.
| Compound Name | 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 60781874 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzamide |
| SMILES | Cc1c(NC(C)c2ccc(Br)cc2Br)cccc1C(N)=O |
| InChI | InChI=1S/C16H16Br2N2O/c1-9-12(16(19)21)4-3-5-15(9)20-10(2)13-7-6-11(17)8-14(13)18/h3-8,10,20H,1-2H3,(H2,19,21) |
| InChIKey | AZRXLNBDVVZQNY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |